Products 15255-31-9
CAS 15255-31-9 appears in our catalog under these names: 4-Bromo-2,3-dihydro-1H-indene-1,3-dione, 4-bromo-2,3-dihydro-1H-indene-1,3-dione, 97%, 97%, 4-Bromo-1H-indene-1,3(2H)-dione, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 1g.
4-bromoindene-1,3-dione (CAS 15255-31-9) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 4-bromoindene-1,3-dione. InChIKey: SQBHQKFWZYZVAT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 4-bromoindene-1,3-dione |
| InChIKey | SQBHQKFWZYZVAT-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C1=O)C(=CC=C2)Br |
Computed by PubChem (NCBI)