CAS 152586-90-8 is the registry number for N-(2,4-Dimethoxyphenyl)-4-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,4-dimethoxyphenyl)-4-nitrobenzamide (CAS 152586-90-8) is a chemical compound with the molecular formula C15H14N2O5 and a molecular weight of 302.28 g/mol. IUPAC name: N-(2,4-dimethoxyphenyl)-4-nitrobenzamide. InChIKey: XUJKRQHILJWOBB-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O5 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | N-(2,4-dimethoxyphenyl)-4-nitrobenzamide |
| InChIKey | XUJKRQHILJWOBB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)C2=CC=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)