Products 365542-66-1
CAS 365542-66-1 is the registry number for Methyl (E)-2-(2-(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)vinyl)-6-methoxybenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(E)-2-(2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]-6-methoxybenzoate (CAS 365542-66-1) is a chemical compound with the molecular formula C15H14N2O5 and a molecular weight of 302.28 g/mol. IUPAC name: methyl 2-[(E)-2-(2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]-6-methoxybenzoate. InChIKey: BFLAJUDLVFSXLI-VOTSOKGWSA-N.
| Molecular formula | C15H14N2O5 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | methyl 2-[(E)-2-(2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]-6-methoxybenzoate |
| InChIKey | BFLAJUDLVFSXLI-VOTSOKGWSA-N |
| SMILES | COC1=CC=CC(=C1C(=O)OC)/C=C/C2=CC(=O)NC(=O)N2 |
Computed by PubChem (NCBI)