Products 76177-28-1
CAS 76177-28-1 appears in our catalog under these names: Mimocine, Mimocin. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, Get quote.
N-[(7-methoxy-6-methyl-5,8-dioxoisoquinolin-1-yl)methyl]-2-oxopropanamide (CAS 76177-28-1) is a chemical compound with the molecular formula C15H14N2O5 and a molecular weight of 302.28 g/mol. IUPAC name: N-[(7-methoxy-6-methyl-5,8-dioxoisoquinolin-1-yl)methyl]-2-oxopropanamide. InChIKey: IYYSRVPPIJVVJO-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O5 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | N-[(7-methoxy-6-methyl-5,8-dioxoisoquinolin-1-yl)methyl]-2-oxopropanamide |
| InChIKey | IYYSRVPPIJVVJO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)C=CN=C2CNC(=O)C(=O)C)OC |
Computed by PubChem (NCBI)