CAS 455887-65-7 is the registry number for N-(3,4-Dimethoxyphenyl)(2-nitrophenyl)formamide. Offered by: Biosynth. Available pack sizes: 10g, 25g.
N-(3,4-dimethoxyphenyl)-2-nitrobenzamide (CAS 455887-65-7) is a chemical compound with the molecular formula C15H14N2O5 and a molecular weight of 302.28 g/mol. IUPAC name: N-(3,4-dimethoxyphenyl)-2-nitrobenzamide. InChIKey: DMTIPURYTPEYCG-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O5 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | N-(3,4-dimethoxyphenyl)-2-nitrobenzamide |
| InChIKey | DMTIPURYTPEYCG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C2=CC=CC=C2[N+](=O)[O-])OC |
Computed by PubChem (NCBI)