Products 157754-77-3

CAS 157754-77-3 is the registry number for 2-(3-(((Benzyloxy)carbonyl)amino)-2-oxopyridin-1(2H)-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetic acid (CAS 157754-77-3) is a chemical compound with the molecular formula C15H14N2O5 and a molecular weight of 302.28 g/mol. IUPAC name: 2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetic acid. InChIKey: HCOXTMQFPXVEPG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N2O5
Molecular weight302.28 g/mol
IUPAC name2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetic acid
InChIKeyHCOXTMQFPXVEPG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NC2=CC=CN(C2=O)CC(=O)O

Computed by PubChem (NCBI)