CAS 1526-17-6 appears in our catalog under these names: 2–Fluoro–6–nitrophenol, 2-Fluoro-6-nitrophenol, 98+% , 6-Fluoro-2-nitrophenol 98%, 2-Fluoro-6-nitrophenol, 97%, 2-Fluoro-6-nitrophenol, >98.0%(GC). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, TCI. Available pack sizes: 100g, 25g, 500g, 1g, 5g, 10g.
2-fluoro-6-nitrophenol (CAS 1526-17-6) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 2-fluoro-6-nitrophenol. InChIKey: HIGRXCJEFUYRNW-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 2-fluoro-6-nitrophenol |
| InChIKey | HIGRXCJEFUYRNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)