Products 152613-43-9
CAS 152613-43-9 is the registry number for Methyl (2alpha(E),3beta)-3-Methyl-5-(3-methyl-3-(4-methyl-3-pentenyl)oxiranyl)-2-pentenoic Acid Ester. Offered by: TRC. Available pack sizes: 250mg.
Methyl (E)-3-methyl-5-[(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pent-2-enoate (CAS 152613-43-9) is a chemical compound with the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. IUPAC name: methyl (E)-3-methyl-5-[(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pent-2-enoate. InChIKey: HODRQGNLKOVWET-QNICALHASA-N.
| Molecular formula | C16H26O3 |
|---|---|
| Molecular weight | 266.38 g/mol |
| IUPAC name | methyl (E)-3-methyl-5-[(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pent-2-enoate |
| InChIKey | HODRQGNLKOVWET-QNICALHASA-N |
| SMILES | CC(=CCC[C@]1([C@@H](O1)CC/C(=C/C(=O)OC)/C)C)C |
Computed by PubChem (NCBI)