Products 951116-89-5
CAS 951116-89-5 appears in our catalog under these names: trans-trans-10,11-Epoxy Farnesenic Acid-d3 Methyl Ester, >95% (HPLC), (Rac)–Juvenile Hormone III–d3, (Rac)-Juvenile Hormone III-d3, 97.89%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
Trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate (CAS 951116-89-5) is a chemical compound with the molecular formula C16H26O3 and a molecular weight of 269.39 g/mol. IUPAC name: trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate. InChIKey: QVJMXSGZTCGLHZ-DGRYHQRESA-N.
| Molecular formula | C16H26O3 |
|---|---|
| Molecular weight | 269.39 g/mol |
| IUPAC name | trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate |
| InChIKey | QVJMXSGZTCGLHZ-DGRYHQRESA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)/C=C(\C)/CC/C=C(\C)/CCC1C(O1)(C)C |
Computed by PubChem (NCBI)