CAS 26544-38-7 appears in our catalog under these names: 2–Dodecen–1–Ylsuccinic Anhydride, Tetrapropenylsuccinic Anhydride (mixture of branched chain isomers), >85.0%(T), EPOXY EMBEDDING MEDIUM, HARDENER DDSA, DODECENYLSUCCINIC ANHYDRIDE, TECH., 90%&, 3-(Dodec-2-En-1-Yl)Dihydrofuran-2,5-Dione, 95% (mixture of isomers), 95% (mixture of isomers). Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 500g, 25g, 250ML, 1L, 100g, 1kg, 1 g, 5 g.
3-[(E)-dodec-9-enyl]oxolane-2,5-dione (CAS 26544-38-7) is a chemical compound with the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. IUPAC name: 3-[(E)-dodec-9-enyl]oxolane-2,5-dione. InChIKey: AMEIILZCUWMPEV-ONEGZZNKSA-N.
| Molecular formula | C16H26O3 |
|---|---|
| Molecular weight | 266.38 g/mol |
| IUPAC name | 3-[(E)-dodec-9-enyl]oxolane-2,5-dione |
| InChIKey | AMEIILZCUWMPEV-ONEGZZNKSA-N |
| SMILES | CC/C=C/CCCCCCCCC1CC(=O)OC1=O |
Computed by PubChem (NCBI)