Products 951116-90-8
CAS 951116-90-8 is the registry number for cis-trans-10,11-Epoxy Farnesenic Acid-d3 Methyl Ester (>85%). Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
Trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate (CAS 951116-90-8) is a chemical compound with the molecular formula C16H26O3 and a molecular weight of 269.39 g/mol. IUPAC name: trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate. InChIKey: QVJMXSGZTCGLHZ-DGRYHQRESA-N.
| Molecular formula | C16H26O3 |
|---|---|
| Molecular weight | 269.39 g/mol |
| IUPAC name | trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate |
| InChIKey | QVJMXSGZTCGLHZ-DGRYHQRESA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)/C=C(\C)/CC/C=C(\C)/CCC1C(O1)(C)C |
Computed by PubChem (NCBI)