Products 26462-74-8
CAS 26462-74-8 is the registry number for Methyl (4S)-4-((1R)-1,5-dimethyl-3-oxohexyl)-1-cyclohexene-1-carboxylate (mixture of diastereomers). Offered by: TRC. Available pack sizes: 10mg.
Methyl (4S)-4-[(2R)-6-methyl-4-oxoheptan-2-yl]cyclohexene-1-carboxylate (CAS 26462-74-8) is a chemical compound with the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. IUPAC name: methyl (4S)-4-[(2R)-6-methyl-4-oxoheptan-2-yl]cyclohexene-1-carboxylate. InChIKey: IIWNDLDEVPJIBT-CHWSQXEVSA-N.
| Molecular formula | C16H26O3 |
|---|---|
| Molecular weight | 266.38 g/mol |
| IUPAC name | methyl (4S)-4-[(2R)-6-methyl-4-oxoheptan-2-yl]cyclohexene-1-carboxylate |
| InChIKey | IIWNDLDEVPJIBT-CHWSQXEVSA-N |
| SMILES | C[C@H](CC(=O)CC(C)C)[C@H]1CCC(=CC1)C(=O)OC |
Computed by PubChem (NCBI)