CAS 125489-21-6 appears in our catalog under these names: 1-(3,5-Di-tert-butyl-4-hydroxyphenyl)-1,2-ethanediol, >95% (HPLC), 1–(3,5–Di–tert–butyl–4–hydroxyphenyl)–1,2–ethanediol, 1-(3,5-Di-tert-butyl-4-hydroxyphenyl)ethane-1,2-diol. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 50 mg, 25 mg, 10 mg, 1 mg, 5 mg.
1-(3,5-ditert-butyl-4-hydroxyphenyl)ethane-1,2-diol (CAS 125489-21-6) is a chemical compound with the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. IUPAC name: 1-(3,5-ditert-butyl-4-hydroxyphenyl)ethane-1,2-diol. InChIKey: GPHPOIDLODPOAP-UHFFFAOYSA-N.
| Molecular formula | C16H26O3 |
|---|---|
| Molecular weight | 266.38 g/mol |
| IUPAC name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)ethane-1,2-diol |
| InChIKey | GPHPOIDLODPOAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C(CO)O |
Computed by PubChem (NCBI)