Products 152784-32-2
CAS 152784-32-2 is the registry number for Puerol A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
3-(2,4-dihydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-2H-furan-5-one (CAS 152784-32-2) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: 3-(2,4-dihydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-2H-furan-5-one. InChIKey: AYXZYYUMEUUTRQ-UHFFFAOYSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 3-(2,4-dihydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-2H-furan-5-one |
| InChIKey | AYXZYYUMEUUTRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2C(=CC(=O)O2)C3=C(C=C(C=C3)O)O)O |
Computed by PubChem (NCBI)