Products 15297-92-4
CAS 15297-92-4 appears in our catalog under these names: Xyloidone/ 98.61% (existing batch purity), Dehydro-α-lapachone, LDN-22684, >98.0%(HPLC), Dehydro-α-lapachone, 98.77%. Offered by: TargetMol, Biosynth, TCI, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 50mg, 10 mg, 1 mg, 5 mg.
2,2-dimethylbenzo[g]chromene-5,10-dione (CAS 15297-92-4) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2,2-dimethylbenzo[g]chromene-5,10-dione. InChIKey: OWFHAMHRUCUSRM-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2,2-dimethylbenzo[g]chromene-5,10-dione |
| InChIKey | OWFHAMHRUCUSRM-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C(=O)C3=CC=CC=C3C2=O)C |
Computed by PubChem (NCBI)