CAS 15317-58-5 appears in our catalog under these names: 1H-Indole-3-carboxylic acid hydrazide, 98%, 1H-Indole-3-carboxylic acid hydrazide, >95% (HPLC), 1H-Indole-3-carbohydrazide, 97%, 97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
1H-indole-3-carbohydrazide (CAS 15317-58-5) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 1H-indole-3-carbohydrazide. InChIKey: QHUYDKZSGDJDSC-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 1H-indole-3-carbohydrazide |
| InChIKey | QHUYDKZSGDJDSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)NN |
Computed by PubChem (NCBI)