Products 3116614-89-9
CAS 3116614-89-9 is the registry number for (S)-2-Amino-3-(9-oxo-9H-thioxanthen-2-yl)propanoic Acid, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-amino-3-(9-oxothioxanthen-2-yl)propanoic acid (CAS 3116614-89-9) is a chemical compound with the molecular formula C16H13NO3S and a molecular weight of 299.3 g/mol. IUPAC name: 2-amino-3-(9-oxothioxanthen-2-yl)propanoic acid. InChIKey: PGYDVFPQXDLACU-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 2-amino-3-(9-oxothioxanthen-2-yl)propanoic acid |
| InChIKey | PGYDVFPQXDLACU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)C=CC(=C3)CC(C(=O)O)N |
Computed by PubChem (NCBI)