CAS 1533519-92-4 appears in our catalog under these names: 4–Cyclopropylnaphthalen–1–Amine Hydrochloride, 4-Cyclopropylnaphthalen-1-amine hydrochloride 97%, 4-CYCLOPROPYLNAPHTHALEN-1-AMINE HYDROCHLORIDE, 98%, 4-Cyclopropyl-1-Naphthalenamine Hydrochloride, 98%, 98%, Lesinurad Impurity 14 HCl. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Chemat Brand. Available pack sizes: 5g, 1g, 10g, 25g, 100g, on request.
4-cyclopropylnaphthalen-1-amine;hydrochloride (CAS 1533519-92-4) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 4-cyclopropylnaphthalen-1-amine;hydrochloride. InChIKey: CIQWZUGROQAMOL-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 4-cyclopropylnaphthalen-1-amine;hydrochloride |
| InChIKey | CIQWZUGROQAMOL-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N.Cl |
Computed by PubChem (NCBI)