Products 153624-44-3
CAS 153624-44-3 appears in our catalog under these names: 4-Isobutoxyphenylboronic acid, 98%, 4–Isobutoxyphenylboronic acid(contains varying amounts of Anhydride), (4-Isobutoxyphenyl)boronic acid 95%, (4-Isobutoxyphenyl)boronic acid, 95%, 95%, (4-Isobutoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
[4-(2-methylpropoxy)phenyl]boronic acid (CAS 153624-44-3) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: [4-(2-methylpropoxy)phenyl]boronic acid. InChIKey: UCIPLLNDFCCBAC-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | [4-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | UCIPLLNDFCCBAC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC(C)C)(O)O |
Computed by PubChem (NCBI)