CAS 153632-04-3 is the registry number for 2,2,8-Trimethyl-4H-benzo[d][1,3]dioxin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,8-trimethyl-1,3-benzodioxin-4-one (CAS 153632-04-3) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 2,2,8-trimethyl-1,3-benzodioxin-4-one. InChIKey: QSWBPMZFVPTBAT-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2,2,8-trimethyl-1,3-benzodioxin-4-one |
| InChIKey | QSWBPMZFVPTBAT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)OC(O2)(C)C |
Computed by PubChem (NCBI)