CAS 1537175-04-4 is the registry number for Methyl 2-amino-2-(3,5-difluorophenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-amino-2-(3,5-difluorophenyl)propanoate (CAS 1537175-04-4) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: methyl 2-amino-2-(3,5-difluorophenyl)propanoate. InChIKey: OCSLSMFDIOJPGQ-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | methyl 2-amino-2-(3,5-difluorophenyl)propanoate |
| InChIKey | OCSLSMFDIOJPGQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)F)F)(C(=O)OC)N |
Computed by PubChem (NCBI)