CAS 936630-56-7 appears in our catalog under these names: (R)-3-Amino-4-(2,5-difluorophenyl)butanoic acid, 98%, Sitagliptin Impurity 109, (R)-3-Amino-4-(2,5-difluorophenyl)butanoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(3R)-3-amino-4-(2,5-difluorophenyl)butanoic acid (CAS 936630-56-7) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: (3R)-3-amino-4-(2,5-difluorophenyl)butanoic acid. InChIKey: DUIVDEIRNDVPPF-MRVPVSSYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | (3R)-3-amino-4-(2,5-difluorophenyl)butanoic acid |
| InChIKey | DUIVDEIRNDVPPF-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1F)C[C@H](CC(=O)O)N)F |
Computed by PubChem (NCBI)