CAS 1336324-29-8 is the registry number for (S)-3-Amino-4-(2,4-difluorophenyl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3S)-3-amino-4-(2,4-difluorophenyl)butanoic acid (CAS 1336324-29-8) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: (3S)-3-amino-4-(2,4-difluorophenyl)butanoic acid. InChIKey: UJSFLDYTZWFWMS-QMMMGPOBSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | (3S)-3-amino-4-(2,4-difluorophenyl)butanoic acid |
| InChIKey | UJSFLDYTZWFWMS-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)