CAS 1956375-96-4 is the registry number for tert-Butyl 2,6-difluoronicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
Tert-butyl 2,6-difluoropyridine-3-carboxylate (CAS 1956375-96-4) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: tert-butyl 2,6-difluoropyridine-3-carboxylate. InChIKey: JLWDDNJEXNNIBW-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | tert-butyl 2,6-difluoropyridine-3-carboxylate |
| InChIKey | JLWDDNJEXNNIBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=C(C=C1)F)F |
Computed by PubChem (NCBI)