Products 1213546-05-4
CAS 1213546-05-4 is the registry number for Methyl (2r)-2-amino-3-(2,4-difluorophenyl)propanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl (2R)-2-amino-3-(2,4-difluorophenyl)propanoate (CAS 1213546-05-4) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: methyl (2R)-2-amino-3-(2,4-difluorophenyl)propanoate. InChIKey: WTDVYINTUREYJH-SECBINFHSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(2,4-difluorophenyl)propanoate |
| InChIKey | WTDVYINTUREYJH-SECBINFHSA-N |
| SMILES | COC(=O)[C@@H](CC1=C(C=C(C=C1)F)F)N |
Computed by PubChem (NCBI)