Products 243134-92-1
CAS 243134-92-1 is the registry number for 2,2-Difluoro-n-(propan-2-yl)-2h-1,3-benzodioxol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2-difluoro-N-propan-2-yl-1,3-benzodioxol-5-amine (CAS 243134-92-1) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: 2,2-difluoro-N-propan-2-yl-1,3-benzodioxol-5-amine. InChIKey: NQYCCHDABHNUNH-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2,2-difluoro-N-propan-2-yl-1,3-benzodioxol-5-amine |
| InChIKey | NQYCCHDABHNUNH-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)