Products 1537677-81-8

CAS 1537677-81-8 is the registry number for 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-chlorobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 1537677-81-8) is a chemical compound with the molecular formula C22H16ClNO4 and a molecular weight of 393.8 g/mol. IUPAC name: 3-chloro-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: RERJJQOVTCSBKY-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16ClNO4
Molecular weight393.8 g/mol
IUPAC name3-chloro-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid
InChIKeyRERJJQOVTCSBKY-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=CC(=C4)C(=O)O)Cl

Computed by PubChem (NCBI)