CAS 186320-16-1 appears in our catalog under these names: Fmoc–5–amino–2–chlorobenzoic acid, 2-chloro-5-{((9H-fluoren-9-ylmethoxy)carbonyl)amino}benzoic acid, Fmoc-5-amino-2-chlorobenzoic acid, 98%, 98%, 5-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-chlorobenzoic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-chloro-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 186320-16-1) is a chemical compound with the molecular formula C22H16ClNO4 and a molecular weight of 393.8 g/mol. IUPAC name: 2-chloro-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: VWTRRFPVEGOECO-UHFFFAOYSA-N.
| Molecular formula | C22H16ClNO4 |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | 2-chloro-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | VWTRRFPVEGOECO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=C(C=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)