CAS 332121-92-3 appears in our catalog under these names: 2-(Fmoc-amino)-4-chlorobenzoic acid, 97%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-chlorobenzoic acid, 98%, 2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–4–chlorobenzoic acid, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-chlorobenzoic acid, 2-(Fmoc-amino)-4-chlorobenzoic acid 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 332121-92-3) is a chemical compound with the molecular formula C22H16ClNO4 and a molecular weight of 393.8 g/mol. IUPAC name: 4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: USPYMVNYANTVJU-UHFFFAOYSA-N.
| Molecular formula | C22H16ClNO4 |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | 4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | USPYMVNYANTVJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4)C(=O)O)Cl |
Computed by PubChem (NCBI)