CAS 186320-13-8 appears in our catalog under these names: N-Fmoc-4-amino-2-chlorobenzoic acid, 95%, 4-(Fmoc-amino)-2-chloro-benzoic acid, Fmoc-4-NH2-2-Cl-benzoic Acid 95%, 4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-chlorobenzoic acid, 95%, 95%, 2-Chloro-4-{[(9h-fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 0,5g.
2-chloro-4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 186320-13-8) is a chemical compound with the molecular formula C22H16ClNO4 and a molecular weight of 393.8 g/mol. IUPAC name: 2-chloro-4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: GXXAGPZCPKDNHU-UHFFFAOYSA-N.
| Molecular formula | C22H16ClNO4 |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | 2-chloro-4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | GXXAGPZCPKDNHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=C(C=C4)C(=O)O)Cl |
Computed by PubChem (NCBI)