CAS 186320-11-6 appears in our catalog under these names: Fmoc-3-amino-4-chlorobenzoic acid, 95%, Fmoc-3-amino-4-chlorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 186320-11-6) is a chemical compound with the molecular formula C22H16ClNO4 and a molecular weight of 393.8 g/mol. IUPAC name: 4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: USPYMVNYANTVJU-UHFFFAOYSA-N.
| Molecular formula | C22H16ClNO4 |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | 4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | USPYMVNYANTVJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4)C(=O)O)Cl |
Computed by PubChem (NCBI)