Products 1537694-52-2
CAS 1537694-52-2 appears in our catalog under these names: 1-(3-Bromo-4-methylphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%, 1-(3-Bromo-4-methylphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95%, 1-(3-bromo-4-methylphenyl)-1,3-diazinane-2,4-dione, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
1-(3-bromo-4-methylphenyl)-1,3-diazinane-2,4-dione (CAS 1537694-52-2) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 1-(3-bromo-4-methylphenyl)-1,3-diazinane-2,4-dione. InChIKey: SRRFCPYHDCVTTQ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 1-(3-bromo-4-methylphenyl)-1,3-diazinane-2,4-dione |
| InChIKey | SRRFCPYHDCVTTQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2CCC(=O)NC2=O)Br |
Computed by PubChem (NCBI)