Products 1538042-16-8
CAS 1538042-16-8 is the registry number for 5-(tert-Butyl)-2,3-dihydrobenzofuran-3-aceticAcid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(5-tert-butyl-2,3-dihydro-1-benzofuran-3-yl)acetic acid (CAS 1538042-16-8) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 2-(5-tert-butyl-2,3-dihydro-1-benzofuran-3-yl)acetic acid. InChIKey: CKJSRBCSUSLJRO-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 2-(5-tert-butyl-2,3-dihydro-1-benzofuran-3-yl)acetic acid |
| InChIKey | CKJSRBCSUSLJRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OCC2CC(=O)O |
Computed by PubChem (NCBI)