CAS 1538430-09-9 is the registry number for 6-Chloro-2-benzoxazolecarboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g.
Methyl 6-chloro-1,3-benzoxazole-2-carboxylate (CAS 1538430-09-9) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 6-chloro-1,3-benzoxazole-2-carboxylate. InChIKey: CUIFELSKOYSNJT-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 6-chloro-1,3-benzoxazole-2-carboxylate |
| InChIKey | CUIFELSKOYSNJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(O1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)