CAS 153969-11-0 is the registry number for Fenamidone Metabolite, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg.
3-anilino-5-methyl-5-phenylimidazolidine-2,4-dione (CAS 153969-11-0) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: 3-anilino-5-methyl-5-phenylimidazolidine-2,4-dione. InChIKey: KTUBSXMBPVHJQY-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 3-anilino-5-methyl-5-phenylimidazolidine-2,4-dione |
| InChIKey | KTUBSXMBPVHJQY-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)NC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)