CAS 332855-88-6 appears in our catalog under these names: Fenamidone Metabolite, >95% (HPLC), Fenamidone Metabolite. Offered by: TRC, HPC Standards. Available pack sizes: 25mg, 5mg, 1x100mg.
(5S)-3-anilino-5-methyl-5-phenylimidazolidine-2,4-dione (CAS 332855-88-6) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: (5S)-3-anilino-5-methyl-5-phenylimidazolidine-2,4-dione. InChIKey: KTUBSXMBPVHJQY-INIZCTEOSA-N.
| Molecular formula | C16H15N3O2 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | (5S)-3-anilino-5-methyl-5-phenylimidazolidine-2,4-dione |
| InChIKey | KTUBSXMBPVHJQY-INIZCTEOSA-N |
| SMILES | C[C@@]1(C(=O)N(C(=O)N1)NC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)