CAS 1539750-84-9 is the registry number for 4-Oxo-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-5,6-dihydropyrrolo[2,1-e]pyrazole-3-carboxylic acid (CAS 1539750-84-9) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 4-oxo-5,6-dihydropyrrolo[2,1-e]pyrazole-3-carboxylic acid. InChIKey: GBPUQMUGKAFXDY-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 4-oxo-5,6-dihydropyrrolo[2,1-e]pyrazole-3-carboxylic acid |
| InChIKey | GBPUQMUGKAFXDY-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(C=N2)C(=O)O)C1=O |
Computed by PubChem (NCBI)