Products 1540188-38-2
CAS 1540188-38-2 appears in our catalog under these names: 5–Bromo–3–chloro–2–methylbenzoic acid, 5-Bromo-3-chloro-2-methylbenzoic acid, 5-Bromo-3-chloro-2-methylbenzoic acid 95%, 5-Bromo-3-chloro-2-methylbenzoic acid, 98%, 5-Bromo-3-chloro-2-methylbenzoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 10g, 50mg, 250mg, 5g.
5-bromo-3-chloro-2-methylbenzoic acid (CAS 1540188-38-2) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 5-bromo-3-chloro-2-methylbenzoic acid. InChIKey: FMMKWJSZMUYJAR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 5-bromo-3-chloro-2-methylbenzoic acid |
| InChIKey | FMMKWJSZMUYJAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)