Products 1541168-84-6
CAS 1541168-84-6 is the registry number for 3-bromo-2-fluoro-5-hydroxybenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-2-fluoro-5-hydroxybenzoic acid (CAS 1541168-84-6) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 3-bromo-2-fluoro-5-hydroxybenzoic acid. InChIKey: SSCPVOWKROLSGF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 3-bromo-2-fluoro-5-hydroxybenzoic acid |
| InChIKey | SSCPVOWKROLSGF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)Br)O |
Computed by PubChem (NCBI)