Products 154146-07-3
CAS 154146-07-3 appears in our catalog under these names: 2-Amino-5-phenyl-4,6-pyrimidinediol, 95%, 2-Amino-5-phenyl-4,6-pyrimidinediol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
2-amino-4-hydroxy-5-phenyl-1H-pyrimidin-6-one (CAS 154146-07-3) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 2-amino-4-hydroxy-5-phenyl-1H-pyrimidin-6-one. InChIKey: HPPMTXLIFATOQB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 2-amino-4-hydroxy-5-phenyl-1H-pyrimidin-6-one |
| InChIKey | HPPMTXLIFATOQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(NC2=O)N)O |
Computed by PubChem (NCBI)