Products 1541522-02-4

CAS 1541522-02-4 appears in our catalog under these names: 2-(4-Cyclopropylphenyl)-2-hydroxyacetic acid, 2-(4-Cyclopropylphenyl)-2-hydroxyacetic acid 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-cyclopropylphenyl)-2-hydroxyacetic acid (CAS 1541522-02-4) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 2-(4-cyclopropylphenyl)-2-hydroxyacetic acid. InChIKey: UAINOSNYFXMBQO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name2-(4-cyclopropylphenyl)-2-hydroxyacetic acid
InChIKeyUAINOSNYFXMBQO-UHFFFAOYSA-N
SMILESC1CC1C2=CC=C(C=C2)C(C(=O)O)O

Computed by PubChem (NCBI)