CAS 1542166-82-4 appears in our catalog under these names: 15–deoxy–δ12,14–Prostaglandin J2–d4, 15-Deoxy-Δ-12,14-prostaglandin J2-d4, 98.10%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 25μg, 50μg, 25 μg (312.05 μM * 250 μL in Methyl acetate).
(Z)-3,3,4,4-tetradeuterio-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid (CAS 1542166-82-4) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 320.5 g/mol. IUPAC name: (Z)-3,3,4,4-tetradeuterio-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid. InChIKey: VHRUMKCAEVRUBK-NSTSLKHFSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | (Z)-3,3,4,4-tetradeuterio-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| InChIKey | VHRUMKCAEVRUBK-NSTSLKHFSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])/C=C\C[C@H]\1C=CC(=O)/C1=C/C=C/CCCCC |
Computed by PubChem (NCBI)