CAS 1542876-40-3 appears in our catalog under these names: 2-(4-(Aminomethyl)phenyl)-4-methyl-1,2-thiazolidine-1,1-dione, 95%, 2-(4-(Aminomethyl)phenyl)-4-methyl-1,2-thiazolidine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
[4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine (CAS 1542876-40-3) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine. InChIKey: XALMMQHAOXITRN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine |
| InChIKey | XALMMQHAOXITRN-UHFFFAOYSA-N |
| SMILES | CC1CN(S(=O)(=O)C1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)