Products 154407-91-7
CAS 154407-91-7 appears in our catalog under these names: Benzyl 5-aminopentanoate hydrochloride, Benzyl 5-aminopentanoate hydrochloride 95%, Benzyl 5-Aminopentanoate Hydrochloride, 98%, 98%, Benzyl 5-aminopentanoate hydrochloride, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
Benzyl 5-aminopentanoate;hydrochloride (CAS 154407-91-7) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: benzyl 5-aminopentanoate;hydrochloride. InChIKey: BXYROAZHUJRZPD-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | benzyl 5-aminopentanoate;hydrochloride |
| InChIKey | BXYROAZHUJRZPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCN.Cl |
Computed by PubChem (NCBI)