Products 15442-73-6
CAS 15442-73-6 appears in our catalog under these names: Diethyl naphthalene-2,6-dicarboxylate, 95%, Diethyl naphthalene–2，6–dicarboxylate, Diethyl naphthalene-2,6-dicarboxylate 97%, Diethyl naphthalene-2,6-dicarboxylate, 97%, 97%, Diethyl naphthalene-2,6-dicarboxylate, 98%+,RG. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 25g, 1g, 100mg, 10g.
Diethyl naphthalene-2,6-dicarboxylate (CAS 15442-73-6) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: diethyl naphthalene-2,6-dicarboxylate. InChIKey: CSNCOKSAYUDNIE-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | diethyl naphthalene-2,6-dicarboxylate |
| InChIKey | CSNCOKSAYUDNIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)