CAS 1545047-60-6 appears in our catalog under these names: 2,3,4,5-Tetrahydro-1,5-benzothiazepine-1,1-dione, 95%, 2,3,4,5-Tetrahydro-1,5-benzothiazepine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,3,4,5-tetrahydro-1lambda6,5-benzothiazepine 1,1-dioxide (CAS 1545047-60-6) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 2,3,4,5-tetrahydro-1lambda6,5-benzothiazepine 1,1-dioxide. InChIKey: QAWBVAQXGNMILL-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2,3,4,5-tetrahydro-1lambda6,5-benzothiazepine 1,1-dioxide |
| InChIKey | QAWBVAQXGNMILL-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC=CC=C2S(=O)(=O)C1 |
Computed by PubChem (NCBI)