CAS 1545134-39-1 is the registry number for 6-(4-Fluorophenyl)piperidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(4-fluorophenyl)piperidine-2,4-dione (CAS 1545134-39-1) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: 6-(4-fluorophenyl)piperidine-2,4-dione. InChIKey: UKLRYNMMOHQQSJ-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 6-(4-fluorophenyl)piperidine-2,4-dione |
| InChIKey | UKLRYNMMOHQQSJ-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)CC1=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)