Products 1545506-02-2
CAS 1545506-02-2 is the registry number for 5-Chloro-4-hydroxy-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-chloro-4-hydroxy-1H-indole-2-carboxylic acid (CAS 1545506-02-2) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 5-chloro-4-hydroxy-1H-indole-2-carboxylic acid. InChIKey: KIJSJBMUFSQDQM-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 5-chloro-4-hydroxy-1H-indole-2-carboxylic acid |
| InChIKey | KIJSJBMUFSQDQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=C2)C(=O)O)O)Cl |
Computed by PubChem (NCBI)