Products 1545556-69-1
CAS 1545556-69-1 is the registry number for 8-Methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridine (CAS 1545556-69-1) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 8-methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridine. InChIKey: ZKXBJSKFQDRHCH-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 8-methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridine |
| InChIKey | ZKXBJSKFQDRHCH-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)