Products 1547186-75-3
CAS 1547186-75-3 appears in our catalog under these names: 1-(cyclobutylmethyl)-1H-1,3-benzodiazole-4-carboxylic acid, 95%, 1-(Cyclobutylmethyl)-1H-benzo(d)imidazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-(cyclobutylmethyl)benzimidazole-4-carboxylic acid (CAS 1547186-75-3) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 1-(cyclobutylmethyl)benzimidazole-4-carboxylic acid. InChIKey: WSUJGXMCIQGFLE-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-(cyclobutylmethyl)benzimidazole-4-carboxylic acid |
| InChIKey | WSUJGXMCIQGFLE-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CN2C=NC3=C(C=CC=C32)C(=O)O |
Computed by PubChem (NCBI)